| Name | 3-Chlorothiophene-2-carbonyl chloride |
| Synonyms | TIMTEC-BB SBB005473 3-Chloro-2-(chlorocarbonyl)thiophene 3-Chlorothiophene-2-carbonyl chloride 3-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE 2-Thiophenecarbonyl chloride, 3-chloro- 2-Thiophenecarbonyl chloride, 3-chloro- (9CI) |
| CAS | 86427-02-3 |
| InChI | InChI=1/C5H2Cl2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H |
| Molecular Formula | C5H2Cl2OS |
| Molar Mass | 181.04 |
| Density | 1.543g/cm3 |
| Melting Point | 43-44 |
| Boling Point | 113°C 0,5mm |
| Flash Point | 98.5°C |
| Vapor Presure | 0.0405mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.593 |
| Risk Codes | R34 - Causes burns R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 3261 |
| Hazard Note | Irritant |